5-Aminofluorescein, 96%
cas: 3326-34-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-Aminofluorescein, 96% (CAS 3326-34-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g, 100mg, 100g, 250g. Oferty producentów: Ambeed, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A129725-250mg |
| cas | 3326-34-9 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 197,94 Pln | |
| Ambeed | 1g | 281,38 Pln | |
| Ambeed | 5g | 837,62 Pln | |
| Ambeed | 25g | 2845,69 Pln | |
| Chemat | 100mg | 98,00 Pln | |
| Chemat | 250mg | 107,60 Pln | |
| Chemat | 1g | 194,00 Pln | |
| Chemat | 5g | 510,80 Pln | |
| Chemat | 100g | 5958,80 Pln | |
| Chemat | 250g | 12237,20 Pln |
właściwości
| czystość | 96% |
|---|---|
| czas dostawy | 1-2 tygodnie |
6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 3326-34-9) to związek chemiczny o wzorze sumarycznym C20H13NO5 i masie molowej 347.3 g/mol. Nazwa systematyczna IUPAC: 6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: GZAJOEGTZDUSKS-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H13NO5 |
|---|---|
| Masa molowa | 347.3 g/mol |
| Nazwa IUPAC | 6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-Aminofluorescein, 5-fluoresceinamine, Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 5-amino-3',6'-dihydroxy-, Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one, 5-amino-3',6'-dihydroxy-, Fluoresceinamine, Fluoresceinamine Isomer I, Fluoresceinamine, isomer I, Fluoresceinamine, isomer 1, fluorescein-5-amine, 6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one
