Fluoresceinamine, isomer I, 97.00%
cas: 3326-34-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fluoresceinamine, isomer I, 97.00% (CAS 3326-34-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 1g, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | CM92060T-10g |
| cas | 3326-34-9 |
| opakowanie | 10g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 5504,51 Pln | |
| Chemat | 1g | 1005,45 Pln | |
| Chemat | 250mg | 564,26 Pln |
właściwości
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 97.00% |
| kategoria | Chemicals |
6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 3326-34-9) to związek chemiczny o wzorze sumarycznym C20H13NO5 i masie molowej 347.3 g/mol. Nazwa systematyczna IUPAC: 6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: GZAJOEGTZDUSKS-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H13NO5 |
|---|---|
| Masa molowa | 347.3 g/mol |
| Nazwa IUPAC | 6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-Aminofluorescein, 5-fluoresceinamine, Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 5-amino-3',6'-dihydroxy-, Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one, 5-amino-3',6'-dihydroxy-, Fluoresceinamine, Fluoresceinamine Isomer I, Fluoresceinamine, isomer I, Fluoresceinamine, isomer 1, fluorescein-5-amine, 6-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one
