cas: 143499-84-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-Ethenyl-2,2′:5′,2′′-terthiophene, 95%, 95% (CAS 143499-84-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12G5MD-50mg |
| cas | 143499-84-7 |
| opakowanie | 50mg |
| dostępność | 0.2g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 1782,80 Pln | |
| Chemat | 100mg | 2819,60 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
2-ethenyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene (CAS 143499-84-7) to związek chemiczny o wzorze sumarycznym C14H10S3 i masie molowej 274.4 g/mol. Nazwa systematyczna IUPAC: 2-ethenyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene. InChIKey: ADTORIPCMAXQFV-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H10S3 |
|---|---|
| Masa molowa | 274.4 g/mol |
| Nazwa IUPAC | 2-ethenyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene |
| InChIKey | ADTORIPCMAXQFV-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(S1)C2=CC=C(S2)C3=CC=CS3 |
Dane obliczone przez PubChem (NCBI)