AP 18
cas: 55224-94-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
AP 18 (CAS 55224-94-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Oferty producentów: TargetMol, GLPBio.
| producent | TargetMol |
|---|---|
| nr katalogowy | T21543-2mg |
| cas | 55224-94-7 |
| opakowanie | 2mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 2mg | 386,15 Pln | |
| TargetMol | 5mg | 465,53 Pln | |
| TargetMol | 10mg | 618,13 Pln | |
| TargetMol | 25mg | 1096,64 Pln | |
| TargetMol | 50mg | 1620,98 Pln | |
| TargetMol | 100mg | 2438,24 Pln | |
| TargetMol | 500mg | 5001,25 Pln | |
| GLPBio | 10mg | 957,44 Pln | |
| GLPBio | 25mg | 1645,47 Pln | |
| GLPBio | 5mg | 774,90 Pln | |
| GLPBio | 50mg | 2525,41 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | ok. 19 dni |
(NE)-N-[(E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine (CAS 55224-94-7) to związek chemiczny o wzorze sumarycznym C11H12ClNO i masie molowej 209.67 g/mol. Nazwa systematyczna IUPAC: (NE)-N-[(E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine. InChIKey: MHTJEUOFLVQMCL-NJHPPEEMSA-N.
| Wzór sumaryczny | C11H12ClNO |
|---|---|
| Masa molowa | 209.67 g/mol |
| Nazwa IUPAC | (NE)-N-[(E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine |
| InChIKey | MHTJEUOFLVQMCL-NJHPPEEMSA-N |
| SMILES | C/C(=C\C1=CC=C(C=C1)Cl)/C(=N/O)/C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(NE)-N-[(E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine, (2E,3E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-one oxime, (E)-N-[(3E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine, 4-(4-Chlorophenyl)-3-methylbut-3-en-2-one oxime, orb1306305, (E)-4-(4-chlorophenyl)-3-methyl-but-3-en-2-one oxime, N-[(2E,3E)-4-(4-Chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine