cas: 55224-94-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
AP-18, 99.61% (CAS 55224-94-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 50 mg, 10 mg, 25 mg, 5 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W014421-10mM/1mL |
| cas | 55224-94-7 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 50 mg | 1271,71 Pln | |
| MedChemExpress | 10 mg | 505,45 Pln | |
| MedChemExpress | 25 mg | 839,82 Pln | |
| MedChemExpress | 5 mg | 361,49 Pln | |
| MedChemExpress | 100 mg | 1968,31 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.61% |
(NE)-N-[(E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine (CAS 55224-94-7) to związek chemiczny o wzorze sumarycznym C11H12ClNO i masie molowej 209.67 g/mol. Nazwa systematyczna IUPAC: (NE)-N-[(E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine. InChIKey: MHTJEUOFLVQMCL-NJHPPEEMSA-N.
| Wzór sumaryczny | C11H12ClNO |
|---|---|
| Masa molowa | 209.67 g/mol |
| Nazwa IUPAC | (NE)-N-[(E)-4-(4-chlorophenyl)-3-methylbut-3-en-2-ylidene]hydroxylamine |
| InChIKey | MHTJEUOFLVQMCL-NJHPPEEMSA-N |
| SMILES | C/C(=C\C1=CC=C(C=C1)Cl)/C(=N/O)/C |
Dane obliczone przez PubChem (NCBI)