Bis(4-(tert-butyl)phenyl)iodonium hexafluorophosphate(V), 95%
cas: 61358-25-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Bis(4-(tert-butyl)phenyl)iodonium hexafluorophosphate(V), 95% (CAS 61358-25-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 100g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A423349-1g |
| cas | 61358-25-6 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1g | 303,62 Pln | |
| Ambeed | 5g | 759,75 Pln | |
| Ambeed | 10g | 1271,50 Pln | |
| Ambeed | 25g | 2267,19 Pln | |
| Ambeed | 100g | 7095,44 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Bis(4-tert-butylphenyl)iodanium hexafluorophosphate (CAS 61358-25-6) to związek chemiczny o wzorze sumarycznym C20H26F6IP i masie molowej 538.3 g/mol. Nazwa systematyczna IUPAC: bis(4-tert-butylphenyl)iodanium hexafluorophosphate. InChIKey: CJLLNCQWBHTSCB-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H26F6IP |
|---|---|
| Masa molowa | 538.3 g/mol |
| Nazwa IUPAC | bis(4-tert-butylphenyl)iodanium hexafluorophosphate |
| InChIKey | CJLLNCQWBHTSCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[I+]C2=CC=C(C=C2)C(C)(C)C.F[P-](F)(F)(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Bis(4-tert-butylphenyl)iodonium Hexafluorophosphate, Bis(4-(tert-butyl)phenyl)iodonium hexafluorophosphate(V), bis(4-tert-butylphenyl)iodanium;hexafluorophosphate, Bis(4-tert-butylphenyl)iodonium hexafluorophosphate, 98%, Bis(4-tert-butylphenyl)iodanium, Bis[4-(tert-butyl)phenyl]iodonium Hexafluorophosphate(V), 4-tBuPh2I+ PF6-, Bis(4-tert-Butylphenyl) iodonium hexafluorophosphate, CJLLNCQWBHTSCB-UHFFFAOYSA-N, bis(4-tert-butylphenyl)iodonium;hexafluorophosphate