Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate
cas: 61358-25-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate (CAS 61358-25-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100g, 10g, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | CM76610W-100g |
| cas | 61358-25-6 |
| opakowanie | 100g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100g | 8736,24 Pln | |
| Chemat | 10g | 1310,44 Pln | |
| Chemat | 1g | 649,56 Pln |
właściwości
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | no data |
| kategoria | Chemicals |
Bis(4-tert-butylphenyl)iodanium hexafluorophosphate (CAS 61358-25-6) to związek chemiczny o wzorze sumarycznym C20H26F6IP i masie molowej 538.3 g/mol. Nazwa systematyczna IUPAC: bis(4-tert-butylphenyl)iodanium hexafluorophosphate. InChIKey: CJLLNCQWBHTSCB-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H26F6IP |
|---|---|
| Masa molowa | 538.3 g/mol |
| Nazwa IUPAC | bis(4-tert-butylphenyl)iodanium hexafluorophosphate |
| InChIKey | CJLLNCQWBHTSCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[I+]C2=CC=C(C=C2)C(C)(C)C.F[P-](F)(F)(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Bis(4-tert-butylphenyl)iodonium Hexafluorophosphate, Bis(4-(tert-butyl)phenyl)iodonium hexafluorophosphate(V), bis(4-tert-butylphenyl)iodanium;hexafluorophosphate, Bis(4-tert-butylphenyl)iodonium hexafluorophosphate, 98%, Bis(4-tert-butylphenyl)iodanium, Bis[4-(tert-butyl)phenyl]iodonium Hexafluorophosphate(V), 4-tBuPh2I+ PF6-, Bis(4-tert-Butylphenyl) iodonium hexafluorophosphate, CJLLNCQWBHTSCB-UHFFFAOYSA-N, bis(4-tert-butylphenyl)iodonium;hexafluorophosphate