cas: 1186025-29-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
HO-PEG(24)-CO-tbu 95% PEG(24) (CAS 1186025-29-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A986392-100mg |
| cas | 1186025-29-5 |
| opakowanie | 100mg |
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 542,81 Pln | |
| Ambeed | 250mg | 1243,69 Pln | |
| Ambeed | 1g | 2333,94 Pln | |
| Ambeed | 5g | 11378,56 Pln |
| czystość | 95% PEG(24) |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A986392 |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1186025-29-5) to związek chemiczny o wzorze sumarycznym C55H110O27 i masie molowej 1203.4 g/mol. Nazwa systematyczna IUPAC: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: YMILISGQCISYOH-UHFFFAOYSA-N.
| Wzór sumaryczny | C55H110O27 |
|---|---|
| Masa molowa | 1203.4 g/mol |
| Nazwa IUPAC | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | YMILISGQCISYOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Dane obliczone przez PubChem (NCBI)