cas: 543906-09-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Mavoglurant 98% (CAS 543906-09-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A487431-1mg |
| cas | 543906-09-8 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1mg | 648,50 Pln | |
| Ambeed | 5mg | 759,75 Pln | |
| Ambeed | 10mg | 1037,88 Pln | |
| Ambeed | 25mg | 1939,00 Pln | |
| Ambeed | 50mg | 2684,38 Pln | |
| Ambeed | 100mg | 3735,69 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A487431 |
Methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (CAS 543906-09-8) to związek chemiczny o wzorze sumarycznym C19H23NO3 i masie molowej 313.4 g/mol. Nazwa systematyczna IUPAC: methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate. InChIKey: ZFPZEYHRWGMJCV-ZHALLVOQSA-N.
| Wzór sumaryczny | C19H23NO3 |
|---|---|
| Masa molowa | 313.4 g/mol |
| Nazwa IUPAC | methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| InChIKey | ZFPZEYHRWGMJCV-ZHALLVOQSA-N |
| SMILES | CC1=CC(=CC=C1)C#C[C@@]2(CCC[C@@H]3[C@H]2CCN3C(=O)OC)O |
Dane obliczone przez PubChem (NCBI)