cas: 543906-09-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Mavoglurant, 99.88% (CAS 543906-09-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 100 mg, 5 mg, 1 g, 50 mg, 10 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15257-25 mg |
| cas | 543906-09-8 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 2451,29 Pln | |
| MedChemExpress | 100 mg | 4685,05 Pln | |
| MedChemExpress | 5 mg | 983,78 Pln | |
| MedChemExpress | 1 g | 14033,42 Pln | |
| MedChemExpress | 50 mg | 3380,09 Pln | |
| MedChemExpress | 10 mg | 1415,68 Pln | |
| MedChemExpress | 10mM/1mL | 1072,02 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.88% |
Methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (CAS 543906-09-8) to związek chemiczny o wzorze sumarycznym C19H23NO3 i masie molowej 313.4 g/mol. Nazwa systematyczna IUPAC: methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate. InChIKey: ZFPZEYHRWGMJCV-ZHALLVOQSA-N.
| Wzór sumaryczny | C19H23NO3 |
|---|---|
| Masa molowa | 313.4 g/mol |
| Nazwa IUPAC | methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| InChIKey | ZFPZEYHRWGMJCV-ZHALLVOQSA-N |
| SMILES | CC1=CC(=CC=C1)C#C[C@@]2(CCC[C@@H]3[C@H]2CCN3C(=O)OC)O |
Dane obliczone przez PubChem (NCBI)