Methyl (4-nitrophenyl) carbonate, 95%
cas: 17175-16-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl (4-nitrophenyl) carbonate, 95% (CAS 17175-16-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 25g, 100g, 500g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A669403-5g |
| cas | 17175-16-5 |
| opakowanie | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5g | 303,62 Pln | |
| Ambeed | 25g | 804,25 Pln | |
| Ambeed | 100g | 2506,38 Pln | |
| Ambeed | 500g | 10082,50 Pln | |
| BLDpharm | 5g | 292,14 Pln | |
| BLDpharm | 25g | 819,74 Pln | |
| BLDpharm | 100g | 2524,69 Pln | |
| BLDpharm | 500g | 9883,21 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
Methyl (4-nitrophenyl) carbonate (CAS 17175-16-5) to związek chemiczny o wzorze sumarycznym C8H7NO5 i masie molowej 197.14 g/mol. Nazwa systematyczna IUPAC: methyl (4-nitrophenyl) carbonate. InChIKey: BKNCSPZEGXUNTP-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H7NO5 |
|---|---|
| Masa molowa | 197.14 g/mol |
| Nazwa IUPAC | methyl (4-nitrophenyl) carbonate |
| InChIKey | BKNCSPZEGXUNTP-UHFFFAOYSA-N |
| SMILES | COC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Methyl-4-nitrophenylcarbonate, Carbonic acid, methyl 4-nitrophenyl ester, methyl (4-nitrophenyl) carbonate, Methyl p-nitrophenyl carbonate, Methyl 4-nitrophenyl carbonate, Carbonic acid methyl p-nitrophenyl ester, Carbonic acid methyl 4-nitrophenyl ester, Carbonic acid methyl=4-nitrophenyl ester, Carbonic acid methyl(p-nitrophenyl) ester, Carbonic acid, methyl p-nitrophenyl ester