Methyl (4-nitrophenyl) carbonate, 98%
cas: 17175-16-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl (4-nitrophenyl) carbonate, 98% (CAS 17175-16-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g, 100g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11B6VY-250mg |
| cas | 17175-16-5 |
| opakowanie | 250mg |
| dostępność | 400g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 102,80 Pln | |
| Chemat | 5g | 184,40 Pln | |
| Chemat | 25g | 501,20 Pln | |
| Chemat | 100g | 1523,60 Pln | |
| Fluorochem | 25g | 763,29 Pln | |
| Fluorochem | 100g | 2356,48 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl (4-nitrophenyl) carbonate (CAS 17175-16-5) to związek chemiczny o wzorze sumarycznym C8H7NO5 i masie molowej 197.14 g/mol. Nazwa systematyczna IUPAC: methyl (4-nitrophenyl) carbonate. InChIKey: BKNCSPZEGXUNTP-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H7NO5 |
|---|---|
| Masa molowa | 197.14 g/mol |
| Nazwa IUPAC | methyl (4-nitrophenyl) carbonate |
| InChIKey | BKNCSPZEGXUNTP-UHFFFAOYSA-N |
| SMILES | COC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Methyl-4-nitrophenylcarbonate, Carbonic acid, methyl 4-nitrophenyl ester, methyl (4-nitrophenyl) carbonate, Methyl p-nitrophenyl carbonate, Methyl 4-nitrophenyl carbonate, Carbonic acid methyl p-nitrophenyl ester, Carbonic acid methyl 4-nitrophenyl ester, Carbonic acid methyl=4-nitrophenyl ester, Carbonic acid methyl(p-nitrophenyl) ester, Carbonic acid, methyl p-nitrophenyl ester