Phytanic Acid
cas: 14721-66-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Phytanic Acid (CAS 14721-66-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 50mg, 1mg, 2mg. Oferty producentów: GLPBio, TargetMol, Biosynth.
| producent | GLPBio |
|---|---|
| nr katalogowy | GC18486-5 |
| cas | 14721-66-5 |
| opakowanie | 5mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| GLPBio | 5mg | 1027,65 Pln | |
| TargetMol | 5mg | 1667,38 Pln | |
| TargetMol | 10mg | 2975,99 Pln | |
| TargetMol | 25mg | 4895,04 Pln | |
| TargetMol | 50mg | 6422,79 Pln | |
| GLPBio | 10mg | 1570,58 Pln | |
| GLPBio | 25mg | 2380,31 Pln | |
| GLPBio | 50mg | 3129,19 Pln | |
| Biosynth | 1mg | cena na żądanie | |
| Biosynth | 2mg | cena na żądanie |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
3,7,11,15-tetramethylhexadecanoic acid (CAS 14721-66-5) to związek chemiczny o wzorze sumarycznym C20H40O2 i masie molowej 312.5 g/mol. Nazwa systematyczna IUPAC: 3,7,11,15-tetramethylhexadecanoic acid. InChIKey: RLCKHJSFHOZMDR-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H40O2 |
|---|---|
| Masa molowa | 312.5 g/mol |
| Nazwa IUPAC | 3,7,11,15-tetramethylhexadecanoic acid |
| InChIKey | RLCKHJSFHOZMDR-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
PHYTANIC ACID, 3,7,11,15-Tetramethylhexadecanoic acid, Phytanoic acid, Hexadecanoic acid, 3,7,11,15-tetramethyl-, 3,7,11,15-Tetramethyl-hexadecansaeure, 3,7,11,15-tetramethyl-hexadecanoic acid, Acid, Phytanic, 3,7R,11R,15-tetramethyl-hexadecanoic acid, 3,7,11,15-tetramethylhexadecoanoate, 3,7,11,15-tetramethyl-1-hexadecanoic acid