dibenzo[b,d]thiophen-2-ylboronic acid, 98%
cas: 668983-97-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
dibenzo[b,d]thiophen-2-ylboronic acid, 98% (CAS 668983-97-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 50g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1145P0-1g |
| cas | 668983-97-9 |
| opakowanie | 1g |
| dostępność | 96.5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 74,00 Pln | |
| Chemat | 5g | 93,20 Pln | |
| Chemat | 10g | 117,20 Pln | |
| Chemat | 25g | 203,60 Pln | |
| Chemat | 50g | 314,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Dibenzothiophen-2-ylboronic acid (CAS 668983-97-9) to związek chemiczny o wzorze sumarycznym C12H9BO2S i masie molowej 228.08 g/mol. Nazwa systematyczna IUPAC: dibenzothiophen-2-ylboronic acid. InChIKey: CSLSCVHILGCSTE-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H9BO2S |
|---|---|
| Masa molowa | 228.08 g/mol |
| Nazwa IUPAC | dibenzothiophen-2-ylboronic acid |
| InChIKey | CSLSCVHILGCSTE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)SC3=CC=CC=C32)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
dibenzo[b,d]thiophen-2-ylboronic acid, Dibenzothiophen-2-ylboronic Acid, Boronic acid, B-2-dibenzothienyl-, Boronic acid,B-2-ibenzothienyl-, dibenzo[b,d]thiophen-2-yl boronic acid, Dibenzo[b,d]thiophen-2-ylboronic acid (contains varying amounts of Anhydride), Dibenzothiophene-2-boronic Acid(contains varying amounts of Anhydride), Boronic acid, 2-dibenzothienyl-, Dibenzothiophen-2-yl-dihydroxy-borane, 2-dibenzothienylboronic acid