CAS 668983-97-9 występuje w naszej ofercie pod nazwami: Dibenzothiophene-2-boronic acid, Dibenzothiophene–2–boronic Acid(contains varying amounts of Anhydride), Dibenzothiophene-2-boronic Acid (contains varying amounts of Anhydride), Dibenzo[b,d]thiophen-2-ylboronic acid, 95%, May contain varying amounts of anhydride , Dibenzo[b,d]thiophen-2-ylboronic acid 97%. Oferty producentów: TRC, GLPBio, TCI, Thermo Scientific, Ambeed. Dostępne opakowania: 100mg, 250mg, 500mg, 25g, 5g, 1g, 10g, 100g.
Dibenzothiophen-2-ylboronic acid (CAS 668983-97-9) to związek chemiczny o wzorze sumarycznym C12H9BO2S i masie molowej 228.08 g/mol. Nazwa systematyczna IUPAC: dibenzothiophen-2-ylboronic acid. InChIKey: CSLSCVHILGCSTE-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H9BO2S |
|---|---|
| Masa molowa | 228.08 g/mol |
| Nazwa IUPAC | dibenzothiophen-2-ylboronic acid |
| InChIKey | CSLSCVHILGCSTE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)SC3=CC=CC=C32)(O)O |
Dane obliczone przez PubChem (NCBI)