Produkty 106-10-5
CAS 106-10-5 występuje w naszej ofercie pod nazwami: (Ethane-1,2-diylbis(oxy))bis(ethane-2,1-diyl) dioctanoate, 95%, Triethylene glycol bis(octanoate), 95%, 95%. Oferty producentów: Combi-blocks, Chemat. Dostępne opakowania: 1g, 250mg, 100mg.
2-[2-(2-octanoyloxyethoxy)ethoxy]ethyl octanoate (CAS 106-10-5) to związek chemiczny o wzorze sumarycznym C22H42O6 i masie molowej 402.6 g/mol. Nazwa systematyczna IUPAC: 2-[2-(2-octanoyloxyethoxy)ethoxy]ethyl octanoate. InChIKey: YJGHMLJGPSVSLF-UHFFFAOYSA-N.
| Wzór sumaryczny | C22H42O6 |
|---|---|
| Masa molowa | 402.6 g/mol |
| Nazwa IUPAC | 2-[2-(2-octanoyloxyethoxy)ethoxy]ethyl octanoate |
| InChIKey | YJGHMLJGPSVSLF-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCCOCCOCCOC(=O)CCCCCCC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Triethylene glycol dioctanoate, Octanoic acid, diester with triethylene glycol, Octanoic acid, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester, Octanoic acid, ethylenebis(oxyethylene) ester, Octanoic acid, 1,1'-(1,2-ethanediylbis(oxy-2,1-ethanediyl)) ester, Octanoic acid, 1,1'-[1,2-ethanediylbis(oxy-2,1-ethanediyl)] ester, Octanoic acid, ethylenebis(oxyethylene) ester (8CI), Triethylene glycol dicaprylate, (Ethane-1,2-diylbis(oxy))bis(ethane-2,1-diyl) dioctanoate, 2-[2-(2-octanoyloxyethoxy)ethoxy]ethyl octanoate