Produkty 113898-97-8
CAS 113898-97-8 to numer rejestracyjny substancji Cinnamyl 3–aminobut–2–enoate. Oferty producentów: GLPBio. Dostępne opakowania: 5mg.
[(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate (CAS 113898-97-8) to związek chemiczny o wzorze sumarycznym C13H15NO2 i masie molowej 217.26 g/mol. Nazwa systematyczna IUPAC: [(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate. InChIKey: GOWWDIWBLHYGMJ-GZPHBSKSSA-N.
| Wzór sumaryczny | C13H15NO2 |
|---|---|
| Masa molowa | 217.26 g/mol |
| Nazwa IUPAC | [(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate |
| InChIKey | GOWWDIWBLHYGMJ-GZPHBSKSSA-N |
| SMILES | C/C(=C/C(=O)OC/C=C/C1=CC=CC=C1)/N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(E)-Cinnamyl 3-aminobut-2-enoate, 3-Amino Crotonic Acid Cinnamyl Ester, Cinnamyl 3-aminobut-2-enoate, [(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate, Cinnamyl 3-Aminocrotonate, 3-Phenylallyl 3-aminobut-2-enoate, Cilnidipine Impurity 12, (E)-Cinnamyl3-aminobut-2-enoate, (E)-cinnamyl (Z)-3-aminobut-2-enoate, [(E)-cinnamyl] (Z)-3-aminobut-2-enoate