CAS 120293-93-8 występuje w naszej ofercie pod nazwami: Methyl (E)-5-(3-(2-(3,3-dimethyloxiran-2-yl)ethyl)-3-methyloxiran-2-yl)-3-methylpent-2-enoate, 95%, Juvenile Hormone B 3 (Mixture of Diastereomers), Technical Grade, Juvenile hormone B 3 (mixture of diastereomers). Oferty producentów: Chemat Brand, TRC, MedChemExpress. Dostępne opakowania: on request, 0,5mg, 10mg, 2,5mg, 500 μg.
Methyl (E)-5-[3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]-3-methylpent-2-enoate (CAS 120293-93-8) to związek chemiczny o wzorze sumarycznym C16H26O4 i masie molowej 282.37 g/mol. Nazwa systematyczna IUPAC: methyl (E)-5-[3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]-3-methylpent-2-enoate. InChIKey: ZKZPJBPCLACUKB-ZHACJKMWSA-N.
| Wzór sumaryczny | C16H26O4 |
|---|---|
| Masa molowa | 282.37 g/mol |
| Nazwa IUPAC | methyl (E)-5-[3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]-3-methylpent-2-enoate |
| InChIKey | ZKZPJBPCLACUKB-ZHACJKMWSA-N |
| SMILES | C/C(=C\C(=O)OC)/CCC1C(O1)(C)CCC2C(O2)(C)C |
Dane obliczone przez PubChem (NCBI)