Produkty 121571-93-5
CAS 121571-93-5 to numer rejestracyjny substancji 2,5-Dimethylfuran-d6, >95% (GC). Oferty producentów: TRC. Dostępne opakowania: 10mg, 2,5mg.
3,4-dideuterio-2-(deuteriomethyl)-5-(trideuteriomethyl)furan (CAS 121571-93-5) to związek chemiczny o wzorze sumarycznym C6H8O i masie molowej 102.16 g/mol. Nazwa systematyczna IUPAC: 3,4-dideuterio-2-(deuteriomethyl)-5-(trideuteriomethyl)furan. InChIKey: GSNUFIFRDBKVIE-SPDFDVHRSA-N.
| Wzór sumaryczny | C6H8O |
|---|---|
| Masa molowa | 102.16 g/mol |
| Nazwa IUPAC | 3,4-dideuterio-2-(deuteriomethyl)-5-(trideuteriomethyl)furan |
| InChIKey | GSNUFIFRDBKVIE-SPDFDVHRSA-N |
| SMILES | [2H]CC1=C(C(=C(O1)C([2H])([2H])[2H])[2H])[2H] |
Dane obliczone przez PubChem (NCBI)