CAS 1219799-26-4 to numer rejestracyjny substancji Furfuryl-d5-amine, 97 atom % D, min 98% Chemical Purity. Oferty producentów: CDN. Dostępne opakowania: 0,05g, 0,01g.
Dideuterio-(3,4,5-trideuteriofuran-2-yl)methanamine (CAS 1219799-26-4) to związek chemiczny o wzorze sumarycznym C5H7NO i masie molowej 102.15 g/mol. Nazwa systematyczna IUPAC: dideuterio-(3,4,5-trideuteriofuran-2-yl)methanamine. InChIKey: DDRPCXLAQZKBJP-QUWGTZMWSA-N.
| Wzór sumaryczny | C5H7NO |
|---|---|
| Masa molowa | 102.15 g/mol |
| Nazwa IUPAC | dideuterio-(3,4,5-trideuteriofuran-2-yl)methanamine |
| InChIKey | DDRPCXLAQZKBJP-QUWGTZMWSA-N |
| SMILES | [2H]C1=C(OC(=C1[2H])C([2H])([2H])N)[2H] |
Dane obliczone przez PubChem (NCBI)