Produkty 122555-04-8
CAS 122555-04-8 występuje w naszej ofercie pod nazwami: L-4-Acetylphenylalanine (contains up to 20% inorganics), L-4-Acetylphenylalanine, H-Phe(4-Ac)-OH, H–Phe(4–Ac)–OH, 4-Acetyl-L-phenylalanine, 97%, 97%. Oferty producentów: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Dostępne opakowania: 100mg, 25mg, 50mg, 10g, 1g, 250mg, 5g, 100 mg.
(2S)-3-(4-acetylphenyl)-2-aminopropanoic acid (CAS 122555-04-8) to związek chemiczny o wzorze sumarycznym C11H13NO3 i masie molowej 207.23 g/mol. Nazwa systematyczna IUPAC: (2S)-3-(4-acetylphenyl)-2-aminopropanoic acid. InChIKey: ZXSBHXZKWRIEIA-JTQLQIEISA-N.
| Wzór sumaryczny | C11H13NO3 |
|---|---|
| Masa molowa | 207.23 g/mol |
| Nazwa IUPAC | (2S)-3-(4-acetylphenyl)-2-aminopropanoic acid |
| InChIKey | ZXSBHXZKWRIEIA-JTQLQIEISA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
p-acetyl-L-phenylalanine, P-ACETYLPHENYLALANINE, H-Phe(4-Ac)-OH, L-4-Acetylphenylalanine, (S)-3-(4-Acetylphenyl)-2-aminopropanoic acid, (2S)-3-(4-acetylphenyl)-2-aminopropanoic acid, L-Phenylalanine, 4-acetyl-, L-4-acetylphe, Phenylalanine, 4-acetyl-, L-4-Acetylphenylalanine (contains up to 20% inorganics)