Produkty 13038-47-6
CAS 13038-47-6 występuje w naszej ofercie pod nazwami: 9(E),11(E)–Conjugated Linoleic Acid methyl ester, 9(E),11(E)-Conjugated Linoleic Acid methyl ester, 98%, 98%, (9E,11E)-9,11-Octadecadienoic acid methyl ester. Oferty producentów: GLPBio, Chemat, MedChemExpress. Dostępne opakowania: 25mg, 5 mg, 10 mg, 25 mg.
Methyl (9E,11E)-octadeca-9,11-dienoate (CAS 13038-47-6) to związek chemiczny o wzorze sumarycznym C19H34O2 i masie molowej 294.5 g/mol. Nazwa systematyczna IUPAC: methyl (9E,11E)-octadeca-9,11-dienoate. InChIKey: KVIWYYOMPLJRMC-BNFZFUHLSA-N.
| Wzór sumaryczny | C19H34O2 |
|---|---|
| Masa molowa | 294.5 g/mol |
| Nazwa IUPAC | methyl (9E,11E)-octadeca-9,11-dienoate |
| InChIKey | KVIWYYOMPLJRMC-BNFZFUHLSA-N |
| SMILES | CCCCCC/C=C/C=C/CCCCCCCC(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Methyl-9,11-octadecadienoate, Methyl 9,11-octadecadienoate, (E,E)-, 9,11-Octadecadienoic acid, methyl ester, (9E,11E)-, methyl (9E,11E)-octadeca-9,11-dienoate, (9E,11E)-9,11-Octadecadienoic acid methyl ester, 9(E),11(E)-Conjugated Linoleic Acid methyl ester, 9(Z),11(E)-Conjugated linoleic acid methyl ester, 9(Z),11(Z)-Conjugated linoleic acid methyl ester, methyl isolinoleate, Methyl ester of cla (9-cis,11-trans)