CAS 1448858-61-4 to numer rejestracyjny substancji 2'-Amino-2,2,2-trifluoro-4'-(trifluoromethyl)acetophenone, 95%. Oferty producentów: Combi-blocks. Dostępne opakowania: 1g, 250mg.
1-[2-amino-4-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone (CAS 1448858-61-4) to związek chemiczny o wzorze sumarycznym C9H5F6NO i masie molowej 257.13 g/mol. Nazwa systematyczna IUPAC: 1-[2-amino-4-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone. InChIKey: GVXKLCBPDVZTPN-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H5F6NO |
|---|---|
| Masa molowa | 257.13 g/mol |
| Nazwa IUPAC | 1-[2-amino-4-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone |
| InChIKey | GVXKLCBPDVZTPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)C(=O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)