Produkty 15119-62-7
CAS 15119-62-7 to numer rejestracyjny substancji p-Nitrophenylthiol Acetate, >95% (HPLC). Oferty producentów: TRC. Dostępne opakowania: 100mg, 1g, 500mg.
S-(4-nitrophenyl) ethanethioate (CAS 15119-62-7) to związek chemiczny o wzorze sumarycznym C8H7NO3S i masie molowej 197.21 g/mol. Nazwa systematyczna IUPAC: S-(4-nitrophenyl) ethanethioate. InChIKey: QCGPFSMQZNLBCA-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H7NO3S |
|---|---|
| Masa molowa | 197.21 g/mol |
| Nazwa IUPAC | S-(4-nitrophenyl) ethanethioate |
| InChIKey | QCGPFSMQZNLBCA-UHFFFAOYSA-N |
| SMILES | CC(=O)SC1=CC=C(C=C1)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
p-Nitrophenylthiol acetate, 4-Nitrophenylthiol acetate, Ethanethioic acid, S-(4-nitrophenyl) ester, S-(4-nitrophenyl) ethanethioate, S-(p-Nitrophenyl) thioacetate, Benzenethiol, p-nitro-, acetate, 1-[(4-nitrophenyl)sulfanyl]ethan-1-one, ACETIC ACID, THIO-, S-(p-NITROPHENYL) ESTER, S-(4-nitrophenyl) thioacetate, S-(4-nitrophenyl)ethanethioate