Produkty 1670260-03-3
CAS 1670260-03-3 to numer rejestracyjny substancji tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate. Oferty producentów: Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate (CAS 1670260-03-3) to związek chemiczny o wzorze sumarycznym C11H18F3NO3 i masie molowej 269.26 g/mol. Nazwa systematyczna IUPAC: tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: QYOHWKPQQOXOFE-SNVBAGLBSA-N.
| Wzór sumaryczny | C11H18F3NO3 |
|---|---|
| Masa molowa | 269.26 g/mol |
| Nazwa IUPAC | tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | QYOHWKPQQOXOFE-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](C1)(C(F)(F)F)O |
Dane obliczone przez PubChem (NCBI)