Produkty 1797883-74-9
CAS 1797883-74-9 występuje w naszej ofercie pod nazwami: Flurbiprofen EP Impurity B, Flurbiprofen Impurity B, Flurbiprofen EP Impurity B (Mixture of Diastereomers), Flurbiprofen Impurity 2（EP Impurity B）, 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)-2,3-dimethylsuccinic acid, 97%. Oferty producentów: Chemat Brand, Hubei YoungXin, TRC. Dostępne opakowania: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3-fluoro-4-phenylphenyl)-2,3-dimethylbutanedioic acid (CAS 1797883-74-9) to związek chemiczny o wzorze sumarycznym C18H17FO4 i masie molowej 316.3 g/mol. Nazwa systematyczna IUPAC: 2-(3-fluoro-4-phenylphenyl)-2,3-dimethylbutanedioic acid. InChIKey: YVWIRDHPNGRLMV-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H17FO4 |
|---|---|
| Masa molowa | 316.3 g/mol |
| Nazwa IUPAC | 2-(3-fluoro-4-phenylphenyl)-2,3-dimethylbutanedioic acid |
| InChIKey | YVWIRDHPNGRLMV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)C(C)(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Flurbiprofen EP Impurity B, 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)-2,3-dimethylsuccinic acid, Flurbiprofen Impurity B, 2-(2-Fluoro[1,1'-biphenyl]-4-yl)-2,3-dimethylbutanedioic Acid, 2-(3-fluoro-4-phenylphenyl)-2,3-dimethylbutanedioic acid, Fluspirilene EP Impurity B, Flurbiprofen EP Impurity B (Mixture of Diastereomers), 2-(2-fluorobiphenyl-4-yl)-2,3- dimethylbutanedioic acid, 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)-2,3-dimethylsuccinicacid