CAS 185855-30-5 występuje w naszej ofercie pod nazwami: 1,2,4-Cyclohexanetricarboxylic acid trimethyl ester, 95%, Trimethyl 1,2,4–Cyclohexanetricarboxylate (cis– and trans– mixture), Trimethyl 1,2,4-Cyclohexanetricarboxylate (cis- and trans- mixture), >97.0%(GC), Trimethyl cyclohexane-1,2,4-tricarboxylate 95%, 1,2,4-Cyclohexanetricarboxylic acid trimethyl ester, 95%, 95%. Oferty producentów: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Dostępne opakowania: 1g, 5g, 100g, 200mg, 25g, 250mg.
Trimethyl cyclohexane-1,2,4-tricarboxylate (CAS 185855-30-5) to związek chemiczny o wzorze sumarycznym C12H18O6 i masie molowej 258.27 g/mol. Nazwa systematyczna IUPAC: trimethyl cyclohexane-1,2,4-tricarboxylate. InChIKey: DEIJHCATUHBNIH-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H18O6 |
|---|---|
| Masa molowa | 258.27 g/mol |
| Nazwa IUPAC | trimethyl cyclohexane-1,2,4-tricarboxylate |
| InChIKey | DEIJHCATUHBNIH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC(C(C1)C(=O)OC)C(=O)OC |
Dane obliczone przez PubChem (NCBI)