Produkty 201802-67-7
CAS 201802-67-7 występuje w naszej ofercie pod nazwami: 4–(Diphenylamino)phenylboronic acid, 4-(Diphenylamino)phenylboronic Acid (contains varying amounts of Anhydride), 4-(Diphenylamino)benzeneboronic acid 98%, 4-(DIPHENYLAMINO)PHENYLBORONIC ACID, >=, 4-(Diphenylamino)phenylboronic acid, 99%, 99%. Oferty producentów: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Dostępne opakowania: 100g, 25g, 5g, 1g, 10g, 500g, 1000g, 5kg.
[4-(N-phenylanilino)phenyl]boronic acid (CAS 201802-67-7) to związek chemiczny o wzorze sumarycznym C18H16BNO2 i masie molowej 289.1 g/mol. Nazwa systematyczna IUPAC: [4-(N-phenylanilino)phenyl]boronic acid. InChIKey: TWWQCBRELPOMER-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H16BNO2 |
|---|---|
| Masa molowa | 289.1 g/mol |
| Nazwa IUPAC | [4-(N-phenylanilino)phenyl]boronic acid |
| InChIKey | TWWQCBRELPOMER-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-(Diphenylamino)phenylboronic acid (contains varying amounts of Anhydride), 4-(Diphenylamino)phenylboronic acid, [4-(N-phenylanilino)phenyl]boronic acid, 4-(Diphenylamino)benzeneboronic acid, (4-(diphenylamino)phenyl)boronic acid, Triphenylamine-4-boronic Acid, Boronic acid, B-[4-(diphenylamino)phenyl]-, [4-(Diphenylamino)phenyl]boronic acid, 4-(N,N-Diphenylamino)phenylboronic acid, 4-Diphenylamino-phenylboronic acid