CAS 2225181-76-8 to numer rejestracyjny substancji 2,6-Dimethyl-1-((E)-2-nitroethenyl)piperidine. Oferty producentów: Biosynth. Dostępne opakowania: 50mg, 0,5g.
2,6-dimethyl-1-[(E)-2-nitroethenyl]piperidine (CAS 2225181-76-8) to związek chemiczny o wzorze sumarycznym C9H16N2O2 i masie molowej 184.24 g/mol. Nazwa systematyczna IUPAC: 2,6-dimethyl-1-[(E)-2-nitroethenyl]piperidine. InChIKey: BPKXPMUQJBACBP-VOTSOKGWSA-N.
| Wzór sumaryczny | C9H16N2O2 |
|---|---|
| Masa molowa | 184.24 g/mol |
| Nazwa IUPAC | 2,6-dimethyl-1-[(E)-2-nitroethenyl]piperidine |
| InChIKey | BPKXPMUQJBACBP-VOTSOKGWSA-N |
| SMILES | CC1CCCC(N1/C=C/[N+](=O)[O-])C |
Dane obliczone przez PubChem (NCBI)