Produkty 29909-02-2
CAS 29909-02-2 występuje w naszej ofercie pod nazwami: Isoleucine-d10 (mixture of diastereomers), Isoleucine-d10 (mixture of diastereomers), 99 atom % D, min 98% Chemical Purity, DL–Isoleucine–d10, DL-Isoleucine-d10, 98.6%. Oferty producentów: TRC, CDN, GLPBio, MedChemExpress. Dostępne opakowania: 10mg, 1mg, 2mg, 0,1g, 0,05g, 25mg, 5mg, 1 mg.
2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid (CAS 29909-02-2) to związek chemiczny o wzorze sumarycznym C6H13NO2 i masie molowej 141.23 g/mol. Nazwa systematyczna IUPAC: 2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid. InChIKey: AGPKZVBTJJNPAG-SHJFKSRGSA-N.
| Wzór sumaryczny | C6H13NO2 |
|---|---|
| Masa molowa | 141.23 g/mol |
| Nazwa IUPAC | 2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid |
| InChIKey | AGPKZVBTJJNPAG-SHJFKSRGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(C(=O)O)N |
Dane obliczone przez PubChem (NCBI)