Produkty 32210-23-4
CAS 32210-23-4 występuje w naszej ofercie pod nazwami: 4-tert-Butylcyclohexyl acetate, 96%, 4-tert-Butylcyclohexyl acetate, mixture, 4-(tert-Butyl)cyclohexyl acetate, 98%, 4-Tert-Butylcyclohexyl acetate, ISO 17034 RM, 4–tert–Butylcyclohexyl Acetate (cis– and trans– mixture). Oferty producentów: Combi-blocks, Sigma-Aldrich, AmBeed, HPC Standards, GLPBio. Dostępne opakowania: 100g, 1g, 5g, 25g, 500g, 10mg, 500ml, 25ml.
(4-tert-butylcyclohexyl) acetate (CAS 32210-23-4) to związek chemiczny o wzorze sumarycznym C12H22O2 i masie molowej 198.30 g/mol. Nazwa systematyczna IUPAC: (4-tert-butylcyclohexyl) acetate. InChIKey: MBZRJSQZCBXRGK-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H22O2 |
|---|---|
| Masa molowa | 198.30 g/mol |
| Nazwa IUPAC | (4-tert-butylcyclohexyl) acetate |
| InChIKey | MBZRJSQZCBXRGK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC(CC1)C(C)(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-tert-Butylcyclohexyl acetate, 4-tert-Butylcyclohexanol acetate, p-tert-Butylcyclohexyl acetate, Cyclohexanol, 4-tert-butyl-, acetate, Cyclohexanol, 4-(1,1-dimethylethyl)-, acetate, Cyclohexanol, 4-(1,1-dimethylethyl)-, 1-acetate, Vertenex, cis-4-tert-Butylcyclohexyl acetate, (4-tert-butylcyclohexyl) acetate, p-tert-Butyl cyclohexyl acetate