Produkty 333432-28-3
CAS 333432-28-3 występuje w naszej ofercie pod nazwami: 9,9–Dimethylfluoren–2–boronic Acid (contains varying amounts of Anhydride), 9,9-Dimethylfluoren-2-boronic Acid (contains varying amounts of Anhydride), 9,9-Dimethyl-9H-fluoren-2-ylboronic acid, 96%. Oferty producentów: GLPBio, TCI, Fluorochem. Dostępne opakowania: 25g, 1g, 5g, 10g, 100g.
(9,9-dimethylfluoren-2-yl)boronic acid (CAS 333432-28-3) to związek chemiczny o wzorze sumarycznym C15H15BO2 i masie molowej 238.09 g/mol. Nazwa systematyczna IUPAC: (9,9-dimethylfluoren-2-yl)boronic acid. InChIKey: DMDPAJOXRYGXCB-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H15BO2 |
|---|---|
| Masa molowa | 238.09 g/mol |
| Nazwa IUPAC | (9,9-dimethylfluoren-2-yl)boronic acid |
| InChIKey | DMDPAJOXRYGXCB-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3C2(C)C)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid, 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid, 9,9-dimethyl-9H-fluoren-2-ylboronic acid, (9,9-dimethylfluoren-2-yl)boronic acid, 9,9-dimethyl-2-fluoreneboronic acid, 9,9-Dimethylfluoren-2-boronic Acid, 9,9-dimethylfluorene-2-boronic acid, 9,9-dimethyl-9H-fluorene-2-ylboronic acid, 9,9-Dimethylfluoren-2-boronic Acid (contains varying amounts of Anhydride), 9,9-Dimethyl-9H-fluoren-2-yl-2-boronic acid