CAS 39813-48-4 występuje w naszej ofercie pod nazwami: Isosorbide Impurity 14, Isosorbide Impurity 1 (Diluted with Lactose), Isosorbide Impurity 1, (3S,3aR,6R,6aS)-6-(Nitrooxy)hexahydrofuro[3,2-b]furan-3-yl acetate, 95%, 95%. Oferty producentów: Chemat Brand, Hubei YoungXin, Chemat. Dostępne opakowania: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
[(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate (CAS 39813-48-4) to związek chemiczny o wzorze sumarycznym C8H11NO7 i masie molowej 233.18 g/mol. Nazwa systematyczna IUPAC: [(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate. InChIKey: RFCPWRHGGSRYGX-LXGUWJNJSA-N.
| Wzór sumaryczny | C8H11NO7 |
|---|---|
| Masa molowa | 233.18 g/mol |
| Nazwa IUPAC | [(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate |
| InChIKey | RFCPWRHGGSRYGX-LXGUWJNJSA-N |
| SMILES | CC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)