CAS 51045-01-3 to numer rejestracyjny substancji Diethyl-2,2,2,2',2',2'-d6-amine, 98 atom % D, min 98% Chemical Purity. Oferty producentów: CDN. Dostępne opakowania: 0,25g, 0,1g.
2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine (CAS 51045-01-3) to związek chemiczny o wzorze sumarycznym C4H11N i masie molowej 79.17 g/mol. Nazwa systematyczna IUPAC: 2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine. InChIKey: HPNMFZURTQLUMO-WFGJKAKNSA-N.
| Wzór sumaryczny | C4H11N |
|---|---|
| Masa molowa | 79.17 g/mol |
| Nazwa IUPAC | 2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine |
| InChIKey | HPNMFZURTQLUMO-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])CNCC([2H])([2H])[2H] |
Dane obliczone przez PubChem (NCBI)