CAS 5122-94-1 występuje w naszej ofercie pod nazwami: 4-Biphenylboronic acid, 98%, 4-Biphenylboronic acid/ 99.53% (existing batch purity), 4–Biphenylboronic acid(contains varying amounts of Anhydride), Biphenyl-4-boronic acid, 97+% , 4-Biphenylboronic acid, 97%. Oferty producentów: Combi-blocks, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros). Dostępne opakowania: 25g, 100g, 500g, 5g, 200mg, 1g, 10g, 250g.
(4-phenylphenyl)boronic acid (CAS 5122-94-1) to związek chemiczny o wzorze sumarycznym C12H11BO2 i masie molowej 198.03 g/mol. Nazwa systematyczna IUPAC: (4-phenylphenyl)boronic acid. InChIKey: XPEIJWZLPWNNOK-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H11BO2 |
|---|---|
| Masa molowa | 198.03 g/mol |
| Nazwa IUPAC | (4-phenylphenyl)boronic acid |
| InChIKey | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |
Dane obliczone przez PubChem (NCBI)