Produkty 55419-66-4
CAS 55419-66-4 to numer rejestracyjny substancji Phenethyl 2,2,2-trifluoroacetate, 95%. Oferty producentów: Ambeed, Chemat, BLDpharm. Dostępne opakowania: 250mg, 1g, 5g.
2-phenylethyl 2,2,2-trifluoroacetate (CAS 55419-66-4) to związek chemiczny o wzorze sumarycznym C10H9F3O2 i masie molowej 218.17 g/mol. Nazwa systematyczna IUPAC: 2-phenylethyl 2,2,2-trifluoroacetate. InChIKey: JQKSSRRXELCGQS-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H9F3O2 |
|---|---|
| Masa molowa | 218.17 g/mol |
| Nazwa IUPAC | 2-phenylethyl 2,2,2-trifluoroacetate |
| InChIKey | JQKSSRRXELCGQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCOC(=O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-Phenylethyl trifluoroacetate, phenethyl 2,2,2-trifluoroacetate, Trifluoro-acetic acid phenethyl ester, 2,2,2-trifluoroacetic acid 2-phenylethyl ester, 1-Trifluoroacetyloxy-2-phenylethane, 1-phenethyl trifluoroacetate, phenethyl2,2,2-trifluoroacetate, 2-Phenylethyl trifluoroacetate #, Acetic acid, trifluoro-, 2-phenylethyl ester, Acetic acid, 2,2,2-trifluoro-, 2-phenylethyl ester