Produkty 6898-97-1
CAS 6898-97-1 występuje w naszej ofercie pod nazwami: Diethylstilbestrol, 98%, 4,4'-(Hex-3-ene-3,4-diyl)diphenol, 98%, Diethylstilbestrol, mixture of cis and trans, Diethylstilbestrol, >98.0%(GC), Diethylstilbestrol (mixture of Isomers). Oferty producentów: Combi-blocks, AmBeed, GLPBio, TCI, HPC Standards. Dostępne opakowania: 5g, 100g, 25g, 10g, 1g, 250mg, 1x100mg.
4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol (CAS 6898-97-1) to związek chemiczny o wzorze sumarycznym C18H20O2 i masie molowej 268.3 g/mol. Nazwa systematyczna IUPAC: 4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol. InChIKey: RGLYKWWBQGJZGM-ISLYRVAYSA-N.
| Wzór sumaryczny | C18H20O2 |
|---|---|
| Masa molowa | 268.3 g/mol |
| Nazwa IUPAC | 4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
| InChIKey | RGLYKWWBQGJZGM-ISLYRVAYSA-N |
| SMILES | CC/C(=C(/CC)\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)O |
Dane obliczone przez PubChem (NCBI)