Produkty 85317-52-8
CAS 85317-52-8 to numer rejestracyjny substancji 4-Nitro-phenylalanine methyl ester, 96%. Oferty producentów: Combi-blocks. Dostępne opakowania: 5g, 1g.
Methyl 2-amino-3-(4-nitrophenyl)propanoate (CAS 85317-52-8) to związek chemiczny o wzorze sumarycznym C10H12N2O4 i masie molowej 224.21 g/mol. Nazwa systematyczna IUPAC: methyl 2-amino-3-(4-nitrophenyl)propanoate. InChIKey: FUFUQQWIXMPZFU-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H12N2O4 |
|---|---|
| Masa molowa | 224.21 g/mol |
| Nazwa IUPAC | methyl 2-amino-3-(4-nitrophenyl)propanoate |
| InChIKey | FUFUQQWIXMPZFU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=C(C=C1)[N+](=O)[O-])N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Methyl 2-amino-3-(4-nitrophenyl)propanoate, methyl 4-nitrophenylalaninate, 4-Nitro-phenylalanine methyl ester, methyl 2-amino-3-(4-nitrophenyl)propionate, 4-Nitrophenylalanine, methyl ester, 4-Nitrophenylalanine, methyl(ester), 4-Nitro-DL-phenylalanine methyl ester, Phenylalanine, 4-nitro-, methyl ester, Methyl 2-amino-3-(4-nitrophenyl)propanoate #