Produkty 89900-94-7
CAS 89900-94-7 to numer rejestracyjny substancji 3'-Methyl-[1,1'-biphenyl]-4-carboxylic acid methyl ester, 98%. Oferty producentów: Combi-blocks. Dostępne opakowania: 1g, 5g.
Methyl 4-(3-methylphenyl)benzoate (CAS 89900-94-7) to związek chemiczny o wzorze sumarycznym C15H14O2 i masie molowej 226.27 g/mol. Nazwa systematyczna IUPAC: methyl 4-(3-methylphenyl)benzoate. InChIKey: DUPICUHZBSNQFM-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H14O2 |
|---|---|
| Masa molowa | 226.27 g/mol |
| Nazwa IUPAC | methyl 4-(3-methylphenyl)benzoate |
| InChIKey | DUPICUHZBSNQFM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=C(C=C2)C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Methyl 3'-methyl-[1,1'-biphenyl]-4-carboxylate, Methyl 4-(3-methylphenyl)benzoate, methyl 3'-methylbiphenyl-4-carboxylate, 3'-Methyl-[1,1'-biphenyl]-4-carboxylic acid methyl ester, methyl 3'-methyl[1,1'-biphenyl]-4-carboxylate, methyl 4-(m-tolyl)benzoate, Methyl3'-methyl-[1,1'-biphenyl]-4-carboxylate, 3'-Methyl-biphenyl-4-carboxylic acid methyl ester, Methyl 3''-Methyl-[1,1''-biphenyl]-4-carboxylate