CAS 916211-45-5 to numer rejestracyjny substancji (4-Fluorobicyclo[2.2.2]octan-1-yl)methanamine 2,2,2-trifluoroacetate, 98%. Oferty producentów: Chemat Brand. Dostępne opakowania: on request.
(4-fluoro-1-bicyclo[2.2.2]octanyl)methanamine;2,2,2-trifluoroacetic acid (CAS 916211-45-5) to związek chemiczny o wzorze sumarycznym C11H17F4NO2 i masie molowej 271.25 g/mol. Nazwa systematyczna IUPAC: (4-fluoro-1-bicyclo[2.2.2]octanyl)methanamine;2,2,2-trifluoroacetic acid. InChIKey: SNMQPPVGOVOLCX-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H17F4NO2 |
|---|---|
| Masa molowa | 271.25 g/mol |
| Nazwa IUPAC | (4-fluoro-1-bicyclo[2.2.2]octanyl)methanamine;2,2,2-trifluoroacetic acid |
| InChIKey | SNMQPPVGOVOLCX-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(CC2)CN)F.C(=O)(C(F)(F)F)O |
Dane obliczone przez PubChem (NCBI)