CAS 168960-19-8 appears in our catalog under these names: ((1S,4R)-4-Aminocyclopent-2-en-1-yl)methanol hydrochloride, 95%, (1S,4R)-cis-4-Amino-2-cyclopentene-1-methanol Hydrochloride, (1S,4R)-4-Amino-2-cyclopentene-1-methanol hydrochloride, ((1S,4R)-4-Aminocyclopent-2-en-1-yl)methanol hydrochloride, 98%, 98%, ((1S,4R)-4-Aminocyclopent-2-en-1-yl)methanol hydrochloride, 97%. Offered by: Combi-blocks, Mikromol, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 10g, 5g, 25mg, 50g, 250g.
[(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol;hydrochloride (CAS 168960-19-8) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: [(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol;hydrochloride. InChIKey: DFJSXBUVSKWALM-IBTYICNHSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | [(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol;hydrochloride |
| InChIKey | DFJSXBUVSKWALM-IBTYICNHSA-N |
| SMILES | C1[C@@H](C=C[C@@H]1N)CO.Cl |
Computed by PubChem (NCBI)