cas: 1294481-79-0 — see every product listed under this CAS number, including other names
((2R,3R,4R)-3-((4-Chlorobenzoyl)oxy)-4-fluoro-4-methyl-5-oxotetrahydrofuran-2-yl)methyl 4-chlorobenzoate, 97%, 97% (CAS 1294481-79-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111Z5S-100mg |
| cas | 1294481-79-0 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 100g | 3506.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4R)-3-(4-chlorobenzoyl)oxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl 4-chlorobenzoate (CAS 1294481-79-0) is a chemical compound with the molecular formula C20H15Cl2FO6 and a molecular weight of 441.2 g/mol. IUPAC name: [(2R,3R,4R)-3-(4-chlorobenzoyl)oxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl 4-chlorobenzoate. InChIKey: CTNZBYHJBWVNHD-JXXFODFXSA-N.
| Molecular formula | C20H15Cl2FO6 |
|---|---|
| Molecular weight | 441.2 g/mol |
| IUPAC name | [(2R,3R,4R)-3-(4-chlorobenzoyl)oxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl 4-chlorobenzoate |
| InChIKey | CTNZBYHJBWVNHD-JXXFODFXSA-N |
| SMILES | C[C@]1([C@@H]([C@H](OC1=O)COC(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=CC=C(C=C3)Cl)F |
Computed by PubChem (NCBI)