((4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(bis(3,5-di-tert-butylphenyl)methanol), 95%
cas: 871945-77-6 — see every product listed under this CAS number, including other names
((4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(bis(3,5-di-tert-butylphenyl)methanol), 95% (CAS 871945-77-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1486962-250mg |
| cas | 871945-77-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 993.38 Pln | |
| Ambeed | 1g | 2573.12 Pln | |
| BLDpharm | 100mg | 669.79 Pln | |
| BLDpharm | 250mg | 1069.65 Pln | |
| BLDpharm | 1g | 2769.05 Pln | |
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 794.00 Pln | |
| Chemat | 1g | 2032.40 Pln | |
| Fluorochem | 100mg | 898.66 Pln | |
| Fluorochem | 250mg | 1466.17 Pln | |
| Fluorochem | 1g | 3757.03 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
[(4R,5R)-5-[bis(3,5-ditert-butylphenyl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,5-ditert-butylphenyl)methanol (CAS 871945-77-6) is a chemical compound with the molecular formula C63H94O4 and a molecular weight of 915.4 g/mol. IUPAC name: [(4R,5R)-5-[bis(3,5-ditert-butylphenyl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,5-ditert-butylphenyl)methanol. InChIKey: AOLVSPGAOMCONB-YWSWRHJRSA-N.
| Molecular formula | C63H94O4 |
|---|---|
| Molecular weight | 915.4 g/mol |
| IUPAC name | [(4R,5R)-5-[bis(3,5-ditert-butylphenyl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,5-ditert-butylphenyl)methanol |
| InChIKey | AOLVSPGAOMCONB-YWSWRHJRSA-N |
| SMILES | CC1(O[C@H]([C@@H](O1)C(C2=CC(=CC(=C2)C(C)(C)C)C(C)(C)C)(C3=CC(=CC(=C3)C(C)(C)C)C(C)(C)C)O)C(C4=CC(=CC(=C4)C(C)(C)C)C(C)(C)C)(C5=CC(=CC(=C5)C(C)(C)C)C(C)(C)C)O)C |
Computed by PubChem (NCBI)