cas: 2173052-77-0 — see every product listed under this CAS number, including other names
([(3S,4R)1-Benzyl-4-(4-methoxyphenyl)pyrrolidin-3-yl)methanol (CAS 2173052-77-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KHHD-50mg |
| cas | 2173052-77-0 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 309.20 Pln | |
| Chemat | 1g | 1782.80 Pln |
| delivery time | 3 weeks |
|---|
[(3S,4R)-1-benzyl-4-(4-methoxyphenyl)pyrrolidin-3-yl]methanol (CAS 2173052-77-0) is a chemical compound with the molecular formula C19H23NO2 and a molecular weight of 297.4 g/mol. IUPAC name: [(3S,4R)-1-benzyl-4-(4-methoxyphenyl)pyrrolidin-3-yl]methanol. InChIKey: CKJNBFHVKVYIDL-HKUYNNGSSA-N.
| Molecular formula | C19H23NO2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | [(3S,4R)-1-benzyl-4-(4-methoxyphenyl)pyrrolidin-3-yl]methanol |
| InChIKey | CKJNBFHVKVYIDL-HKUYNNGSSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2CN(C[C@H]2CO)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)