cas: 133-04-0 — see every product listed under this CAS number, including other names
(-)-Asarinin 99% (CAS 133-04-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A571169-1mg |
| cas | 133-04-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 197.94 Pln | |
| Ambeed | 5mg | 236.88 Pln | |
| Ambeed | 10mg | 303.62 Pln | |
| Ambeed | 25mg | 426.00 Pln | |
| Ambeed | 50mg | 659.62 Pln | |
| Ambeed | 100mg | 1071.25 Pln | |
| Ambeed | 250mg | 1972.38 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A571169 |
5-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole (CAS 133-04-0) is a chemical compound with the molecular formula C20H18O6 and a molecular weight of 354.4 g/mol. IUPAC name: 5-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole. InChIKey: PEYUIKBAABKQKQ-WZBLMQSHSA-N.
| Molecular formula | C20H18O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 5-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole |
| InChIKey | PEYUIKBAABKQKQ-WZBLMQSHSA-N |
| SMILES | C1[C@H]2[C@H](CO[C@@H]2C3=CC4=C(C=C3)OCO4)[C@@H](O1)C5=CC6=C(C=C5)OCO6 |
Computed by PubChem (NCBI)