cas: 1263166-90-0 — see every product listed under this CAS number, including other names
(1α,8α,9β)-Bicyclo[6.1.0]non-4-yn-9-ylmethanol, 98%, 98% (CAS 1263166-90-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110ZWH-10mg |
| cas | 1263166-90-0 |
| size | 10mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 88.40 Pln | |
| Chemat | 25mg | 112.40 Pln | |
| Chemat | 50mg | 136.40 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 683.60 Pln | |
| Chemat | 5g | 2474.00 Pln | |
| Chemat | 10g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methanol (CAS 1263166-90-0) is a chemical compound with the molecular formula C10H14O and a molecular weight of 150.22 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methanol. InChIKey: NSVXZMGWYBICRW-ULKQDVFKSA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 150.22 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methanol |
| InChIKey | NSVXZMGWYBICRW-ULKQDVFKSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2CO)CCC#C1 |
Computed by PubChem (NCBI)