cas: 1190875-39-8 — see every product listed under this CAS number, including other names
(1-(1-(tert-Butoxycarbonyl)piperidin-4-yl)-1H-pyrazol-4-yl)boronic acid, 98% (CAS 1190875-39-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228949-250MG |
| cas | 1190875-39-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1408.90 Pln | |
| Fluorochem | 25g | 6792.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazol-4-yl]boronic acid (CAS 1190875-39-8) is a chemical compound with the molecular formula C13H22BN3O4 and a molecular weight of 295.14 g/mol. IUPAC name: [1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazol-4-yl]boronic acid. InChIKey: BDHMWOQIBZOHFK-UHFFFAOYSA-N.
| Molecular formula | C13H22BN3O4 |
|---|---|
| Molecular weight | 295.14 g/mol |
| IUPAC name | [1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazol-4-yl]boronic acid |
| InChIKey | BDHMWOQIBZOHFK-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)