cas: 1380307-35-6 — see every product listed under this CAS number, including other names
(1-(3-HYDROXY-2,2-DIMETHYLPROPYL)-1H-PYRAZOL-4-YL)BORONIC ACID PINACOL ESTER, 95% (CAS 1380307-35-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F528663-100MG |
| cas | 1380307-35-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1190.22 Pln | |
| Fluorochem | 250mg | 2215.90 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol (CAS 1380307-35-6) is a chemical compound with the molecular formula C14H25BN2O3 and a molecular weight of 280.17 g/mol. IUPAC name: 2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol. InChIKey: ZXULSCHHTCWGTB-UHFFFAOYSA-N.
| Molecular formula | C14H25BN2O3 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol |
| InChIKey | ZXULSCHHTCWGTB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(C)(C)CO |
Computed by PubChem (NCBI)