(1-(tert-Butoxycarbonyl)-5-(trifluoromethyl)-1H-indol-2-yl)boronic acid, 95%
cas: 2304634-92-0 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-5-(trifluoromethyl)-1H-indol-2-yl)boronic acid, 95% (CAS 2304634-92-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A767945-100mg |
| cas | 2304634-92-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 570.62 Pln | |
| Ambeed | 250mg | 1076.81 Pln | |
| Ambeed | 1g | 2506.38 Pln | |
| Ambeed | 5g | 8641.81 Pln | |
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 827.60 Pln | |
| Chemat | 1g | 1974.80 Pln | |
| BLDpharm | 100mg | 614.25 Pln | |
| BLDpharm | 250mg | 1152.95 Pln | |
| BLDpharm | 1g | 2696.85 Pln | |
| BLDpharm | 5g | 9311.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)indol-2-yl]boronic acid (CAS 2304634-92-0) is a chemical compound with the molecular formula C14H15BF3NO4 and a molecular weight of 329.08 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)indol-2-yl]boronic acid. InChIKey: ZCDHMTGOQPAIPQ-UHFFFAOYSA-N.
| Molecular formula | C14H15BF3NO4 |
|---|---|
| Molecular weight | 329.08 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)indol-2-yl]boronic acid |
| InChIKey | ZCDHMTGOQPAIPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(1-(tert-Butoxycarbonyl)-5-(trifluoromethyl)-1H-indol-2-yl)boronic acid, {1-[(tert-butoxy)carbonyl]-5-(trifluoromethyl)-1H-indol-2-yl}boronic acid, [1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(trifluoromethyl)indol-2-yl]boronic acid, 1-(tert-butoxycarbonyl)-5-(trifluoromethoxy)indole-2-boronic acid, (1-(t-Butoxycarbonyl)-5-(trifluoromethyl)-1H-indol-2-yl)boronic acid, 1-Boc-5-(trifluoromethyl)indole-2-boronic acid, 1-(Boc)-5-(trifluoromethyl)-1H-indol-2-boronic acid, 1-Boc-5-(trifluoromethyl)-1H-indole-2-boronic Acid, [1-tert-butoxycarbonyl-5-(trifluoromethyl)indol-2-yl]boronic acid, (1-(tert-Butoxycarbonyl)-5-(trifluoromethyl)-1H-indol-2-yl)boronicacid