(1-(tert-Butoxycarbonyl)-6-((tert-butyldimethylsilyl)oxy)-1H-indol-2-yl)boronic acid, 98%
cas: 848357-99-3 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-6-((tert-butyldimethylsilyl)oxy)-1H-indol-2-yl)boronic acid, 98% (CAS 848357-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1264464-100mg |
| cas | 848357-99-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 915.50 Pln | |
| Ambeed | 1g | 2317.25 Pln | |
| Ambeed | 5g | 7824.12 Pln | |
| BLDpharm | 100mg | 580.93 Pln | |
| BLDpharm | 250mg | 980.79 Pln | |
| BLDpharm | 1g | 2496.92 Pln | |
| BLDpharm | 5g | 8428.17 Pln | |
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 1g | 2310.80 Pln | |
| Chemat | 5g | 7931.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
[6-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 848357-99-3) is a chemical compound with the molecular formula C19H30BNO5Si and a molecular weight of 391.3 g/mol. IUPAC name: [6-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: KOPCAMMFYROHPZ-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO5Si |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | [6-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | KOPCAMMFYROHPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)